C15H21N5O3 — CID 166172986
6-azido-N-[2-[4-(hydroxymethyl)anilino]-2-oxoethyl]hexanamide (PubChem CID 166172986) has the molecular formula C15H21N5O3 and a molecular weight of 319.36 g/mol. Its IUPAC name is 6-azido-N-[2-[4-(hydroxymethyl)anilino]-2-oxoethyl]hexanamide.
| Compound Name | 6-azido-N-[2-[4-(hydroxymethyl)anilino]-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 166172986 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 6-azido-N-[2-[4-(hydroxymethyl)anilino]-2-oxoethyl]hexanamide |
| SMILES | [N-]=[N+]=NCCCCCC(=O)NCC(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C15H21N5O3/c16-20-18-9-3-1-2-4-14(22)17-10-15(23)19-13-7-5-12(11-21)6-8-13/h5-8,21H,1-4,9-11H2,(H,17,22)(H,19,23) |
| InChIKey | WELXDCZWRUTBRS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 127.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|