C26H35N5O7 — CID 167299308
6-(2,5-dioxopyrrol-1-yl)-N-[2-[[(2S)-1-[[2-[4-(hydroxymethyl)anilino]-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-2-oxoethyl]hexanamide (PubChem CID 167299308) has the molecular formula C26H35N5O7 and a molecular weight of 529.59 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-[2-[[(2S)-1-[[2-[4-(hydroxymethyl)anilino]-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-2-oxoethyl]hexanamide.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-[2-[[(2S)-1-[[2-[4-(hydroxymethyl)anilino]-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 167299308 |
| Molecular Formula | C26H35N5O7 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-[2-[[(2S)-1-[[2-[4-(hydroxymethyl)anilino]-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-2-oxoethyl]hexanamide |
| SMILES | CC(C)[C@H](NC(=O)CNC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)NCC(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C26H35N5O7/c1-17(2)25(26(38)28-15-21(34)29-19-9-7-18(16-32)8-10-19)30-22(35)14-27-20(33)6-4-3-5-13-31-23(36)11-12-24(31)37/h7-12,17,25,32H,3-6,13-16H2,1-2H3,(H,27,33)(H,28,38)(H,29,34)(H,30,35)/t25-/m0/s1 |
| InChIKey | XNMXIWSDGKRTQH-VWLOTQADSA-N |
| XLogP | -0.02 |
| TPSA | 174.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|