C40H62BN5O14 — CID 174087329
CID 174087329 (PubChem CID 174087329) has the molecular formula C40H62BN5O14 and a molecular weight of 847.77 g/mol.
| Compound Name | CID 174087329 |
|---|---|
| PubChem CID | 174087329 |
| Molecular Formula | C40H62BN5O14 |
| Molecular Weight | 847.77 g/mol |
| Exact Mass | 847.44 |
| IUPAC Name | — |
| SMILES | [B]Cc1ccc(NC(=O)CNC(=O)C(NC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCN2C(=O)C=CC2=O)C(C)C)cc1 |
| InChI | InChI=1S/C40H62BN5O14/c1-31(2)39(40(52)43-30-36(49)44-33-5-3-32(29-41)4-6-33)45-35(48)10-13-53-15-17-55-19-21-57-23-25-59-27-28-60-26-24-58-22-20-56-18-16-54-14-11-42-34(47)9-12-46-37(50)7-8-38(46)51/h3-8,31,39H,9-30H2,1-2H3,(H,42,47)(H,43,52)(H,44,49)(H,45,48) |
| InChIKey | WSISBVSFGHOVQW-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 227.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.77 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|