C30H45N5O8 — CID 163505382
2-[[2-[3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]-1-hydroxy-3-methylbutyl]amino]-N-(4-ethylphenyl)propanamide (PubChem CID 163505382) has the molecular formula C30H45N5O8 and a molecular weight of 603.72 g/mol. Its IUPAC name is 2-[[2-[3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]-1-hydroxy-3-methylbutyl]amino]-N-(4-ethylphenyl)propanamide.
| Compound Name | 2-[[2-[3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]-1-hydroxy-3-methylbutyl]amino]-N-(4-ethylphenyl)propanamide |
|---|---|
| PubChem CID | 163505382 |
| Molecular Formula | C30H45N5O8 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.33 |
| IUPAC Name | 2-[[2-[3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propanoylamino]-1-hydroxy-3-methylbutyl]amino]-N-(4-ethylphenyl)propanamide |
| SMILES | CCc1ccc(NC(=O)C(C)NC(O)C(NC(=O)CCOCCOCCNC(=O)CCN2C(=O)C=CC2=O)C(C)C)cc1 |
| InChI | InChI=1S/C30H45N5O8/c1-5-22-6-8-23(9-7-22)33-29(40)21(4)32-30(41)28(20(2)3)34-25(37)13-16-42-18-19-43-17-14-31-24(36)12-15-35-26(38)10-11-27(35)39/h6-11,20-21,28,30,32,41H,5,12-19H2,1-4H3,(H,31,36)(H,33,40)(H,34,37) |
| InChIKey | CYDOMQTYBHQPNH-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 175.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|