C35H53N5O10 — CID 177358892
[4-[[2-[[2-[3-[2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethoxy]ethoxy]propanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl acetate;ethane (PubChem CID 177358892) has the molecular formula C35H53N5O10 and a molecular weight of 703.83 g/mol. Its IUPAC name is [4-[[2-[[2-[3-[2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethoxy]ethoxy]propanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl acetate;ethane.
| Compound Name | [4-[[2-[[2-[3-[2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethoxy]ethoxy]propanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl acetate;ethane |
|---|---|
| PubChem CID | 177358892 |
| Molecular Formula | C35H53N5O10 |
| Molecular Weight | 703.83 g/mol |
| Exact Mass | 703.38 |
| IUPAC Name | [4-[[2-[[2-[3-[2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethoxy]ethoxy]propanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl acetate;ethane |
| SMILES | CC.CC(=O)OCc1ccc(NC(=O)CNC(=O)C(NC(=O)CCOCCOCCNC(=O)CCCCCN2C(=O)C=CC2=O)C(C)C)cc1 |
| InChI | InChI=1S/C33H47N5O10.C2H6/c1-23(2)32(33(45)35-21-29(42)36-26-10-8-25(9-11-26)22-48-24(3)39)37-28(41)14-17-46-19-20-47-18-15-34-27(40)7-5-4-6-16-38-30(43)12-13-31(38)44;1-2/h8-13,23,32H,4-7,14-22H2,1-3H3,(H,34,40)(H,35,45)(H,36,42)(H,37,41);1-2H3 |
| InChIKey | WSFRKWORIQNHFJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 198.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.83 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|