C26H36N4O7 — CID 178109922
[4-[[2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]propanoylamino]acetyl]amino]phenyl]methyl acetate;ethane (PubChem CID 178109922) has the molecular formula C26H36N4O7 and a molecular weight of 516.60 g/mol. Its IUPAC name is [4-[[2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]propanoylamino]acetyl]amino]phenyl]methyl acetate;ethane.
| Compound Name | [4-[[2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]propanoylamino]acetyl]amino]phenyl]methyl acetate;ethane |
|---|---|
| PubChem CID | 178109922 |
| Molecular Formula | C26H36N4O7 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | [4-[[2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]propanoylamino]acetyl]amino]phenyl]methyl acetate;ethane |
| SMILES | CC.CC(=O)OCc1ccc(NC(=O)CNC(=O)C(C)NC(=O)CCCCCN2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C24H30N4O7.C2H6/c1-16(26-20(30)6-4-3-5-13-28-22(32)11-12-23(28)33)24(34)25-14-21(31)27-19-9-7-18(8-10-19)15-35-17(2)29;1-2/h7-12,16H,3-6,13-15H2,1-2H3,(H,25,34)(H,26,30)(H,27,31);1-2H3 |
| InChIKey | CCHSHTXDXQKYOO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|