C33H41N5O7 — CID 144752527
[4-[[2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl N-(4-ethylphenyl)carbamate (PubChem CID 144752527) has the molecular formula C33H41N5O7 and a molecular weight of 619.72 g/mol. Its IUPAC name is [4-[[2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl N-(4-ethylphenyl)carbamate.
| Compound Name | [4-[[2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl N-(4-ethylphenyl)carbamate |
|---|---|
| PubChem CID | 144752527 |
| Molecular Formula | C33H41N5O7 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | [4-[[2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl N-(4-ethylphenyl)carbamate |
| SMILES | CCc1ccc(NC(=O)OCc2ccc(NC(=O)CNC(=O)[C@@H](NC(=O)CCCCCN3C(=O)C=CC3=O)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C33H41N5O7/c1-4-23-9-13-26(14-10-23)36-33(44)45-21-24-11-15-25(16-12-24)35-28(40)20-34-32(43)31(22(2)3)37-27(39)8-6-5-7-19-38-29(41)17-18-30(38)42/h9-18,22,31H,4-8,19-21H2,1-3H3,(H,34,43)(H,35,40)(H,36,44)(H,37,39)/t31-/m0/s1 |
| InChIKey | NCIRYNMTRPBAEU-HKBQPEDESA-N |
| XLogP | 3.68 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|