C31H46N6O8 — CID 163250586
[4-[[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl propanoate;propylurea (PubChem CID 163250586) has the molecular formula C31H46N6O8 and a molecular weight of 630.74 g/mol. Its IUPAC name is [4-[[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl propanoate;propylurea.
| Compound Name | [4-[[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl propanoate;propylurea |
|---|---|
| PubChem CID | 163250586 |
| Molecular Formula | C31H46N6O8 |
| Molecular Weight | 630.74 g/mol |
| Exact Mass | 630.34 |
| IUPAC Name | [4-[[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl propanoate;propylurea |
| SMILES | CCC(=O)OCc1ccc(NC(=O)CNC(=O)C(NC(=O)CCCCCN2C(=O)C=CC2=O)C(C)C)cc1.CCCNC(N)=O |
| InChI | InChI=1S/C27H36N4O7.C4H10N2O/c1-4-25(36)38-17-19-9-11-20(12-10-19)29-22(33)16-28-27(37)26(18(2)3)30-21(32)8-6-5-7-15-31-23(34)13-14-24(31)35;1-2-3-6-4(5)7/h9-14,18,26H,4-8,15-17H2,1-3H3,(H,28,37)(H,29,33)(H,30,32);2-3H2,1H3,(H3,5,6,7) |
| InChIKey | BNKQBNMLBWJIBK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 206.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.74 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|