C31H48N6O8 — CID 144713686
6-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutan-2-yl)hexanamide;[4-[(2-formamidoacetyl)amino]phenyl]methyl acetate;propylurea (PubChem CID 144713686) has the molecular formula C31H48N6O8 and a molecular weight of 632.76 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutan-2-yl)hexanamide;[4-[(2-formamidoacetyl)amino]phenyl]methyl acetate;propylurea.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutan-2-yl)hexanamide;[4-[(2-formamidoacetyl)amino]phenyl]methyl acetate;propylurea |
|---|---|
| PubChem CID | 144713686 |
| Molecular Formula | C31H48N6O8 |
| Molecular Weight | 632.76 g/mol |
| Exact Mass | 632.35 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutan-2-yl)hexanamide;[4-[(2-formamidoacetyl)amino]phenyl]methyl acetate;propylurea |
| SMILES | CC(=O)OCc1ccc(NC(=O)CNC=O)cc1.CC(C)C(C)NC(=O)CCCCCN1C(=O)C=CC1=O.CCCNC(N)=O |
| InChI | InChI=1S/C15H24N2O3.C12H14N2O4.C4H10N2O/c1-11(2)12(3)16-13(18)7-5-4-6-10-17-14(19)8-9-15(17)20;1-9(16)18-7-10-2-4-11(5-3-10)14-12(17)6-13-8-15;1-2-3-6-4(5)7/h8-9,11-12H,4-7,10H2,1-3H3,(H,16,18);2-5,8H,6-7H2,1H3,(H,13,15)(H,14,17);2-3H2,1H3,(H3,5,6,7) |
| InChIKey | GLYWDKWCLVELNM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 206.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.76 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|