C32H44N6O9 — CID 176959568
[4-[(2-formamidoacetyl)amino]phenyl]methyl (4-nitrophenyl) carbonate;N-(3-methylbutan-2-yl)hex-5-ynamide;propylurea (PubChem CID 176959568) has the molecular formula C32H44N6O9 and a molecular weight of 656.74 g/mol. Its IUPAC name is [4-[(2-formamidoacetyl)amino]phenyl]methyl (4-nitrophenyl) carbonate;N-(3-methylbutan-2-yl)hex-5-ynamide;propylurea.
| Compound Name | [4-[(2-formamidoacetyl)amino]phenyl]methyl (4-nitrophenyl) carbonate;N-(3-methylbutan-2-yl)hex-5-ynamide;propylurea |
|---|---|
| PubChem CID | 176959568 |
| Molecular Formula | C32H44N6O9 |
| Molecular Weight | 656.74 g/mol |
| Exact Mass | 656.32 |
| IUPAC Name | [4-[(2-formamidoacetyl)amino]phenyl]methyl (4-nitrophenyl) carbonate;N-(3-methylbutan-2-yl)hex-5-ynamide;propylurea |
| SMILES | C#CCCCC(=O)NC(C)C(C)C.CCCNC(N)=O.O=CNCC(=O)Nc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C17H15N3O7.C11H19NO.C4H10N2O/c21-11-18-9-16(22)19-13-3-1-12(2-4-13)10-26-17(23)27-15-7-5-14(6-8-15)20(24)25;1-5-6-7-8-11(13)12-10(4)9(2)3;1-2-3-6-4(5)7/h1-8,11H,9-10H2,(H,18,21)(H,19,22);1,9-10H,6-8H2,2-4H3,(H,12,13);2-3H2,1H3,(H3,5,6,7) |
| InChIKey | KYPFBUBSAVKRLC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 221.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.74 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|