C26H36N4O7 — CID 142322353
ethane;[4-[(2-formamidoacetyl)amino]phenyl]methyl (4-nitrosophenyl) carbonate;N-(3-methylbutan-2-yl)acetamide (PubChem CID 142322353) has the molecular formula C26H36N4O7 and a molecular weight of 516.60 g/mol. Its IUPAC name is ethane;[4-[(2-formamidoacetyl)amino]phenyl]methyl (4-nitrosophenyl) carbonate;N-(3-methylbutan-2-yl)acetamide.
| Compound Name | ethane;[4-[(2-formamidoacetyl)amino]phenyl]methyl (4-nitrosophenyl) carbonate;N-(3-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 142322353 |
| Molecular Formula | C26H36N4O7 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | ethane;[4-[(2-formamidoacetyl)amino]phenyl]methyl (4-nitrosophenyl) carbonate;N-(3-methylbutan-2-yl)acetamide |
| SMILES | CC.CC(=O)NC(C)C(C)C.O=CNCC(=O)Nc1ccc(COC(=O)Oc2ccc(N=O)cc2)cc1 |
| InChI | InChI=1S/C17H15N3O6.C7H15NO.C2H6/c21-11-18-9-16(22)19-13-3-1-12(2-4-13)10-25-17(23)26-15-7-5-14(20-24)6-8-15;1-5(2)6(3)8-7(4)9;1-2/h1-8,11H,9-10H2,(H,18,21)(H,19,22);5-6H,1-4H3,(H,8,9);1-2H3 |
| InChIKey | AJAMDWHCJQXFIP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 152.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|