C17H17N3O6 — CID 143845133
[4-[[2-(methylamino)acetyl]amino]phenyl]methyl (4-nitrophenyl) carbonate (PubChem CID 143845133) has the molecular formula C17H17N3O6 and a molecular weight of 359.34 g/mol. Its IUPAC name is [4-[[2-(methylamino)acetyl]amino]phenyl]methyl (4-nitrophenyl) carbonate.
| Compound Name | [4-[[2-(methylamino)acetyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 143845133 |
| Molecular Formula | C17H17N3O6 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | [4-[[2-(methylamino)acetyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
| SMILES | CNCC(=O)Nc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C17H17N3O6/c1-18-10-16(21)19-13-4-2-12(3-5-13)11-25-17(22)26-15-8-6-14(7-9-15)20(23)24/h2-9,18H,10-11H2,1H3,(H,19,21) |
| InChIKey | MUNKSKCKDLBVDL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|