C27H32N4O9 — CID 158514363
[4-[[(2S,5S)-2-[2-(methylamino)-2-oxoethyl]-5-(2-methylpropanoylamino)-4-oxohexanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate (PubChem CID 158514363) has the molecular formula C27H32N4O9 and a molecular weight of 556.57 g/mol. Its IUPAC name is [4-[[(2S,5S)-2-[2-(methylamino)-2-oxoethyl]-5-(2-methylpropanoylamino)-4-oxohexanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate.
| Compound Name | [4-[[(2S,5S)-2-[2-(methylamino)-2-oxoethyl]-5-(2-methylpropanoylamino)-4-oxohexanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 158514363 |
| Molecular Formula | C27H32N4O9 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | [4-[[(2S,5S)-2-[2-(methylamino)-2-oxoethyl]-5-(2-methylpropanoylamino)-4-oxohexanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
| SMILES | CNC(=O)C[C@H](CC(=O)[C@H](C)NC(=O)C(C)C)C(=O)Nc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C27H32N4O9/c1-16(2)25(34)29-17(3)23(32)13-19(14-24(33)28-4)26(35)30-20-7-5-18(6-8-20)15-39-27(36)40-22-11-9-21(10-12-22)31(37)38/h5-12,16-17,19H,13-15H2,1-4H3,(H,28,33)(H,29,34)(H,30,35)/t17-,19-/m0/s1 |
| InChIKey | IJTWWIJOYDQECF-HKUYNNGSSA-N |
| XLogP | 3.12 |
| TPSA | 183.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|