C36H42N6O11 — CID 159378805
[4-[[(2R,5R)-2-[(E)-3-(carbamoylamino)prop-2-enyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate (PubChem CID 159378805) has the molecular formula C36H42N6O11 and a molecular weight of 734.76 g/mol. Its IUPAC name is [4-[[(2R,5R)-2-[(E)-3-(carbamoylamino)prop-2-enyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate.
| Compound Name | [4-[[(2R,5R)-2-[(E)-3-(carbamoylamino)prop-2-enyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 159378805 |
| Molecular Formula | C36H42N6O11 |
| Molecular Weight | 734.76 g/mol |
| Exact Mass | 734.29 |
| IUPAC Name | [4-[[(2R,5R)-2-[(E)-3-(carbamoylamino)prop-2-enyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
| SMILES | CC(C)[C@@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)C[C@@H](C/C=C/NC(N)=O)C(=O)Nc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C36H42N6O11/c1-23(2)33(40-30(44)8-4-3-5-20-41-31(45)17-18-32(41)46)29(43)21-25(7-6-19-38-35(37)48)34(47)39-26-11-9-24(10-12-26)22-52-36(49)53-28-15-13-27(14-16-28)42(50)51/h6,9-19,23,25,33H,3-5,7-8,20-22H2,1-2H3,(H,39,47)(H,40,44)(H3,37,38,48)/b19-6+/t25-,33-/m1/s1 |
| InChIKey | KBDDFJZWFLTOOS-RCNOIVAVSA-N |
| XLogP | 4.02 |
| TPSA | 246.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.76 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|