C31H44N6O8 — CID 158907315
[4-[[2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl N-methylcarbamate (PubChem CID 158907315) has the molecular formula C31H44N6O8 and a molecular weight of 628.73 g/mol. Its IUPAC name is [4-[[2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl N-methylcarbamate.
| Compound Name | [4-[[2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 158907315 |
| Molecular Formula | C31H44N6O8 |
| Molecular Weight | 628.73 g/mol |
| Exact Mass | 628.32 |
| IUPAC Name | [4-[[2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCc1ccc(NC(=O)C(CCCNC(N)=O)CC(=O)C(NC(=O)CCCCCN2C(=O)C=CC2=O)C(C)C)cc1 |
| InChI | InChI=1S/C31H44N6O8/c1-20(2)28(36-25(39)9-5-4-6-17-37-26(40)14-15-27(37)41)24(38)18-22(8-7-16-34-30(32)43)29(42)35-23-12-10-21(11-13-23)19-45-31(44)33-3/h10-15,20,22,28H,4-9,16-19H2,1-3H3,(H,33,44)(H,35,42)(H,36,39)(H3,32,34,43) |
| InChIKey | KRMWWQCLFFVHCL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 206.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.73 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|