C35H50N6O9 — CID 160694947
[4-[[(2R,5S)-2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl N-(2-oxopentyl)carbamate (PubChem CID 160694947) has the molecular formula C35H50N6O9 and a molecular weight of 698.82 g/mol. Its IUPAC name is [4-[[(2R,5S)-2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl N-(2-oxopentyl)carbamate.
| Compound Name | [4-[[(2R,5S)-2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl N-(2-oxopentyl)carbamate |
|---|---|
| PubChem CID | 160694947 |
| Molecular Formula | C35H50N6O9 |
| Molecular Weight | 698.82 g/mol |
| Exact Mass | 698.36 |
| IUPAC Name | [4-[[(2R,5S)-2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl N-(2-oxopentyl)carbamate |
| SMILES | CCCC(=O)CNC(=O)OCc1ccc(NC(=O)C(CCCNC(N)=O)CC(=O)[C@@H](NC(=O)CCCCCN2C(=O)C=CC2=O)C(C)C)cc1 |
| InChI | InChI=1S/C35H50N6O9/c1-4-9-27(42)21-38-35(49)50-22-24-12-14-26(15-13-24)39-33(47)25(10-8-18-37-34(36)48)20-28(43)32(23(2)3)40-29(44)11-6-5-7-19-41-30(45)16-17-31(41)46/h12-17,23,25,32H,4-11,18-22H2,1-3H3,(H,38,49)(H,39,47)(H,40,44)(H3,36,37,48)/t25?,32-/m0/s1 |
| InChIKey | KUNJAHKHVJEIEW-WYYRYWFOSA-N |
| XLogP | 2.87 |
| TPSA | 223.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.82 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|