C33H47N5O8 — CID 148808289
[4-[[(2R,5S)-2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl 2-methylpropanoate (PubChem CID 148808289) has the molecular formula C33H47N5O8 and a molecular weight of 641.77 g/mol. Its IUPAC name is [4-[[(2R,5S)-2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl 2-methylpropanoate.
| Compound Name | [4-[[(2R,5S)-2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 148808289 |
| Molecular Formula | C33H47N5O8 |
| Molecular Weight | 641.77 g/mol |
| Exact Mass | 641.34 |
| IUPAC Name | [4-[[(2R,5S)-2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCc1ccc(NC(=O)[C@H](CCCNC(N)=O)CC(=O)[C@@H](NC(=O)CCCCCN2C(=O)C=CC2=O)C(C)C)cc1 |
| InChI | InChI=1S/C33H47N5O8/c1-21(2)30(37-27(40)10-6-5-7-18-38-28(41)15-16-29(38)42)26(39)19-24(9-8-17-35-33(34)45)31(43)36-25-13-11-23(12-14-25)20-46-32(44)22(3)4/h11-16,21-22,24,30H,5-10,17-20H2,1-4H3,(H,36,43)(H,37,40)(H3,34,35,45)/t24-,30+/m1/s1 |
| InChIKey | OPKAHZRDCHZACL-HLADLETHSA-N |
| XLogP | 2.97 |
| TPSA | 194.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.77 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|