C32H50BrN5O7 — CID 157441864
[4-[[(2S,5R)-5-[6-[(2-bromoacetyl)amino]hexanoylamino]-2-[3-(carbamoylamino)propyl]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate (PubChem CID 157441864) has the molecular formula C32H50BrN5O7 and a molecular weight of 696.68 g/mol. Its IUPAC name is [4-[[(2S,5R)-5-[6-[(2-bromoacetyl)amino]hexanoylamino]-2-[3-(carbamoylamino)propyl]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[[(2S,5R)-5-[6-[(2-bromoacetyl)amino]hexanoylamino]-2-[3-(carbamoylamino)propyl]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 157441864 |
| Molecular Formula | C32H50BrN5O7 |
| Molecular Weight | 696.68 g/mol |
| Exact Mass | 695.29 |
| IUPAC Name | [4-[[(2S,5R)-5-[6-[(2-bromoacetyl)amino]hexanoylamino]-2-[3-(carbamoylamino)propyl]-6-methyl-4-oxoheptanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)[C@@H](NC(=O)CCCCCNC(=O)CBr)C(=O)C[C@H](CCCNC(N)=O)C(=O)Nc1ccc(COC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H50BrN5O7/c1-21(2)28(38-26(40)11-7-6-8-16-35-27(41)19-33)25(39)18-23(10-9-17-36-31(34)44)29(42)37-24-14-12-22(13-15-24)20-45-30(43)32(3,4)5/h12-15,21,23,28H,6-11,16-20H2,1-5H3,(H,35,41)(H,37,42)(H,38,40)(H3,34,36,44)/t23-,28+/m0/s1 |
| InChIKey | QVMVYOBKARJYLJ-NEKDWFFYSA-N |
| XLogP | 3.95 |
| TPSA | 185.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.68 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|