C30H47IN6O7 — CID 129177817
[4-[[(2R)-5-(carbamoylamino)-2-[[(2R)-2-[5-[(2-iodoacetyl)amino]pentanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate (PubChem CID 129177817) has the molecular formula C30H47IN6O7 and a molecular weight of 730.64 g/mol. Its IUPAC name is [4-[[(2R)-5-(carbamoylamino)-2-[[(2R)-2-[5-[(2-iodoacetyl)amino]pentanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[[(2R)-5-(carbamoylamino)-2-[[(2R)-2-[5-[(2-iodoacetyl)amino]pentanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 129177817 |
| Molecular Formula | C30H47IN6O7 |
| Molecular Weight | 730.64 g/mol |
| Exact Mass | 730.26 |
| IUPAC Name | [4-[[(2R)-5-(carbamoylamino)-2-[[(2R)-2-[5-[(2-iodoacetyl)amino]pentanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)[C@@H](NC(=O)CCCCNC(=O)CI)C(=O)N[C@H](CCCNC(N)=O)C(=O)Nc1ccc(COC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H47IN6O7/c1-19(2)25(37-23(38)10-6-7-15-33-24(39)17-31)27(41)36-22(9-8-16-34-29(32)43)26(40)35-21-13-11-20(12-14-21)18-44-28(42)30(3,4)5/h11-14,19,22,25H,6-10,15-18H2,1-5H3,(H,33,39)(H,35,40)(H,36,41)(H,37,38)(H3,32,34,43)/t22-,25-/m1/s1 |
| InChIKey | TVOMWIKEEAIFLV-RCZVLFRGSA-N |
| XLogP | 2.51 |
| TPSA | 197.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.64 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|