C31H49IN6O7 — CID 139538229
[4-[[(2S)-5-(carbamoylamino)-2-[[2-[5-[(2-iodoacetyl)amino]pentanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl 2,3-dimethylbutanoate (PubChem CID 139538229) has the molecular formula C31H49IN6O7 and a molecular weight of 744.67 g/mol. Its IUPAC name is [4-[[(2S)-5-(carbamoylamino)-2-[[2-[5-[(2-iodoacetyl)amino]pentanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl 2,3-dimethylbutanoate.
| Compound Name | [4-[[(2S)-5-(carbamoylamino)-2-[[2-[5-[(2-iodoacetyl)amino]pentanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl 2,3-dimethylbutanoate |
|---|---|
| PubChem CID | 139538229 |
| Molecular Formula | C31H49IN6O7 |
| Molecular Weight | 744.67 g/mol |
| Exact Mass | 744.27 |
| IUPAC Name | [4-[[(2S)-5-(carbamoylamino)-2-[[2-[5-[(2-iodoacetyl)amino]pentanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl 2,3-dimethylbutanoate |
| SMILES | CC(C)C(C)C(=O)OCc1ccc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)C(NC(=O)CCCCNC(=O)CI)C(C)C)cc1 |
| InChI | InChI=1S/C31H49IN6O7/c1-19(2)21(5)30(43)45-18-22-11-13-23(14-12-22)36-28(41)24(9-8-16-35-31(33)44)37-29(42)27(20(3)4)38-25(39)10-6-7-15-34-26(40)17-32/h11-14,19-21,24,27H,6-10,15-18H2,1-5H3,(H,34,40)(H,36,41)(H,37,42)(H,38,39)(H3,33,35,44)/t21?,24-,27?/m0/s1 |
| InChIKey | BLXRVYVRHXEWJZ-BMMPOPSUSA-N |
| XLogP | 2.76 |
| TPSA | 197.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.67 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|