C32H45N7O9 — CID 121390395
[4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-[6-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl acetate (PubChem CID 121390395) has the molecular formula C32H45N7O9 and a molecular weight of 671.75 g/mol. Its IUPAC name is [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-[6-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl acetate.
| Compound Name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-[6-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 121390395 |
| Molecular Formula | C32H45N7O9 |
| Molecular Weight | 671.75 g/mol |
| Exact Mass | 671.33 |
| IUPAC Name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-[6-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@@H](NC(=O)CCCCCNC(=O)CN2C(=O)C=CC2=O)C(C)C)cc1 |
| InChI | InChI=1S/C32H45N7O9/c1-20(2)29(38-25(41)9-5-4-6-16-34-26(42)18-39-27(43)14-15-28(39)44)31(46)37-24(8-7-17-35-32(33)47)30(45)36-23-12-10-22(11-13-23)19-48-21(3)40/h10-15,20,24,29H,4-9,16-19H2,1-3H3,(H,34,42)(H,36,45)(H,37,46)(H,38,41)(H3,33,35,47)/t24-,29-/m0/s1 |
| InChIKey | DTUVHLUZHVAQMG-OUTSHDOLSA-N |
| XLogP | 0.36 |
| TPSA | 235.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.75 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|