C33H48N6O8S — CID 170216135
[4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl 2,2-dimethyl-3-sulfanylpropanoate (PubChem CID 170216135) has the molecular formula C33H48N6O8S and a molecular weight of 688.85 g/mol. Its IUPAC name is [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl 2,2-dimethyl-3-sulfanylpropanoate.
| Compound Name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl 2,2-dimethyl-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 170216135 |
| Molecular Formula | C33H48N6O8S |
| Molecular Weight | 688.85 g/mol |
| Exact Mass | 688.33 |
| IUPAC Name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl 2,2-dimethyl-3-sulfanylpropanoate |
| SMILES | CC(C)[C@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)N[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(COC(=O)C(C)(C)CS)cc1 |
| InChI | InChI=1S/C33H48N6O8S/c1-21(2)28(38-25(40)10-6-5-7-18-39-26(41)15-16-27(39)42)30(44)37-24(9-8-17-35-32(34)46)29(43)36-23-13-11-22(12-14-23)19-47-31(45)33(3,4)20-48/h11-16,21,24,28,48H,5-10,17-20H2,1-4H3,(H,36,43)(H,37,44)(H,38,40)(H3,34,35,46)/t24-,28-/m0/s1 |
| InChIKey | SMWKZGKWIAGTHA-CUBQBAPOSA-N |
| XLogP | 2.18 |
| TPSA | 206.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.85 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|