C32H44N4O9 — CID 129177868
(4S)-5-[4-(2,2-dimethylpropanoyloxymethyl)anilino]-4-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-5-oxopentanoic acid (PubChem CID 129177868) has the molecular formula C32H44N4O9 and a molecular weight of 628.72 g/mol. Its IUPAC name is (4S)-5-[4-(2,2-dimethylpropanoyloxymethyl)anilino]-4-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-[4-(2,2-dimethylpropanoyloxymethyl)anilino]-4-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 129177868 |
| Molecular Formula | C32H44N4O9 |
| Molecular Weight | 628.72 g/mol |
| Exact Mass | 628.31 |
| IUPAC Name | (4S)-5-[4-(2,2-dimethylpropanoyloxymethyl)anilino]-4-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)N[C@@H](CCC(=O)O)C(=O)Nc1ccc(COC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H44N4O9/c1-20(2)28(35-24(37)9-7-6-8-18-36-25(38)15-16-26(36)39)30(43)34-23(14-17-27(40)41)29(42)33-22-12-10-21(11-13-22)19-45-31(44)32(3,4)5/h10-13,15-16,20,23,28H,6-9,14,17-19H2,1-5H3,(H,33,42)(H,34,43)(H,35,37)(H,40,41)/t23-,28-/m0/s1 |
| InChIKey | XKPRZADRDCCALN-FIPFOOKPSA-N |
| XLogP | 2.69 |
| TPSA | 188.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.72 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|