C30H42N4O9 — CID 170738788
4-[[2-[4-(2,2-dimethylpropanoyloxymethyl)anilino]-2-oxoethyl]amino]-3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxobutanoic acid;ethane (PubChem CID 170738788) has the molecular formula C30H42N4O9 and a molecular weight of 602.69 g/mol. Its IUPAC name is 4-[[2-[4-(2,2-dimethylpropanoyloxymethyl)anilino]-2-oxoethyl]amino]-3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxobutanoic acid;ethane.
| Compound Name | 4-[[2-[4-(2,2-dimethylpropanoyloxymethyl)anilino]-2-oxoethyl]amino]-3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxobutanoic acid;ethane |
|---|---|
| PubChem CID | 170738788 |
| Molecular Formula | C30H42N4O9 |
| Molecular Weight | 602.69 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | 4-[[2-[4-(2,2-dimethylpropanoyloxymethyl)anilino]-2-oxoethyl]amino]-3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxobutanoic acid;ethane |
| SMILES | CC.CC(C)(C)C(=O)OCc1ccc(NC(=O)CNC(=O)C(CC(=O)O)NC(=O)CCCCCN2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C28H36N4O9.C2H6/c1-28(2,3)27(40)41-17-18-8-10-19(11-9-18)30-22(34)16-29-26(39)20(15-25(37)38)31-21(33)7-5-4-6-14-32-23(35)12-13-24(32)36;1-2/h8-13,20H,4-7,14-17H2,1-3H3,(H,29,39)(H,30,34)(H,31,33)(H,37,38);1-2H3 |
| InChIKey | OALMGSAFRDTBES-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 188.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.69 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|