C28H32N4O5 — CID 118066589
6-(2,5-dioxopyrrol-1-yl)-N-[(2S)-1-[[2-(4-methylanilino)-2-oxoethyl]amino]-1-oxo-3-phenylpropan-2-yl]hexanamide (PubChem CID 118066589) has the molecular formula C28H32N4O5 and a molecular weight of 504.59 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-[(2S)-1-[[2-(4-methylanilino)-2-oxoethyl]amino]-1-oxo-3-phenylpropan-2-yl]hexanamide.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-[(2S)-1-[[2-(4-methylanilino)-2-oxoethyl]amino]-1-oxo-3-phenylpropan-2-yl]hexanamide |
|---|---|
| PubChem CID | 118066589 |
| Molecular Formula | C28H32N4O5 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-[(2S)-1-[[2-(4-methylanilino)-2-oxoethyl]amino]-1-oxo-3-phenylpropan-2-yl]hexanamide |
| SMILES | Cc1ccc(NC(=O)CNC(=O)[C@H](Cc2ccccc2)NC(=O)CCCCCN2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C28H32N4O5/c1-20-11-13-22(14-12-20)30-25(34)19-29-28(37)23(18-21-8-4-2-5-9-21)31-24(33)10-6-3-7-17-32-26(35)15-16-27(32)36/h2,4-5,8-9,11-16,23H,3,6-7,10,17-19H2,1H3,(H,29,37)(H,30,34)(H,31,33)/t23-/m0/s1 |
| InChIKey | QMOLHORORXHKIK-QHCPKHFHSA-N |
| XLogP | 2.26 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|