C26H33N5O9 — CID 175012234
2-[[[2-[[(2S)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]methoxy]acetic acid (PubChem CID 175012234) has the molecular formula C26H33N5O9 and a molecular weight of 559.58 g/mol. Its IUPAC name is 2-[[[2-[[(2S)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]methoxy]acetic acid.
| Compound Name | 2-[[[2-[[(2S)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]methoxy]acetic acid |
|---|---|
| PubChem CID | 175012234 |
| Molecular Formula | C26H33N5O9 |
| Molecular Weight | 559.58 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | 2-[[[2-[[(2S)-2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]methoxy]acetic acid |
| SMILES | O=C(O)COCNC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C26H33N5O9/c32-20(9-5-2-6-12-31-23(35)10-11-24(31)36)27-15-22(34)30-19(13-18-7-3-1-4-8-18)26(39)28-14-21(33)29-17-40-16-25(37)38/h1,3-4,7-8,10-11,19H,2,5-6,9,12-17H2,(H,27,32)(H,28,39)(H,29,33)(H,30,34)(H,37,38)/t19-/m0/s1 |
| InChIKey | TWWVIDSPOBKNFO-IBGZPJMESA-N |
| XLogP | -1.39 |
| TPSA | 200.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.58 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|