C25H31N5O7 — CID 172620074
6-(2,5-dioxopyrrol-1-yl)-N-[2-oxo-2-[[2-oxo-2-[[1-oxo-1-(2-oxoethylamino)-3-phenylpropan-2-yl]amino]ethyl]amino]ethyl]hexanamide (PubChem CID 172620074) has the molecular formula C25H31N5O7 and a molecular weight of 513.55 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-[2-oxo-2-[[2-oxo-2-[[1-oxo-1-(2-oxoethylamino)-3-phenylpropan-2-yl]amino]ethyl]amino]ethyl]hexanamide.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-[2-oxo-2-[[2-oxo-2-[[1-oxo-1-(2-oxoethylamino)-3-phenylpropan-2-yl]amino]ethyl]amino]ethyl]hexanamide |
|---|---|
| PubChem CID | 172620074 |
| Molecular Formula | C25H31N5O7 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-[2-oxo-2-[[2-oxo-2-[[1-oxo-1-(2-oxoethylamino)-3-phenylpropan-2-yl]amino]ethyl]amino]ethyl]hexanamide |
| SMILES | O=CCNC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C25H31N5O7/c31-14-12-26-25(37)19(15-18-7-3-1-4-8-18)29-22(34)17-28-21(33)16-27-20(32)9-5-2-6-13-30-23(35)10-11-24(30)36/h1,3-4,7-8,10-11,14,19H,2,5-6,9,12-13,15-17H2,(H,26,37)(H,27,32)(H,28,33)(H,29,34) |
| InChIKey | PYBYKVOCFMVAFD-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|