C33H47N7O8S — CID 170088458
4-[[[2-[[2-[[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]methylsulfanyl]-N,4-dimethylpentanamide (PubChem CID 170088458) has the molecular formula C33H47N7O8S and a molecular weight of 701.85 g/mol. Its IUPAC name is 4-[[[2-[[2-[[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]methylsulfanyl]-N,4-dimethylpentanamide.
| Compound Name | 4-[[[2-[[2-[[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]methylsulfanyl]-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 170088458 |
| Molecular Formula | C33H47N7O8S |
| Molecular Weight | 701.85 g/mol |
| Exact Mass | 701.32 |
| IUPAC Name | 4-[[[2-[[2-[[2-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]methylsulfanyl]-N,4-dimethylpentanamide |
| SMILES | CNC(=O)CCC(C)(C)SCNC(=O)CNC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C33H47N7O8S/c1-33(2,16-15-25(41)34-3)49-22-38-28(44)20-37-32(48)24(18-23-10-6-4-7-11-23)39-29(45)21-36-27(43)19-35-26(42)12-8-5-9-17-40-30(46)13-14-31(40)47/h4,6-7,10-11,13-14,24H,5,8-9,12,15-22H2,1-3H3,(H,34,41)(H,35,42)(H,36,43)(H,37,48)(H,38,44)(H,39,45) |
| InChIKey | OCOPVFLAQZEOON-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 211.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.85 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|