C24H36N6O6S — CID 171831062
4-[[[2-[[2-[[2-[(2-formamidoacetyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]methylsulfanyl]-N,4-dimethylpentanamide (PubChem CID 171831062) has the molecular formula C24H36N6O6S and a molecular weight of 536.66 g/mol. Its IUPAC name is 4-[[[2-[[2-[[2-[(2-formamidoacetyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]methylsulfanyl]-N,4-dimethylpentanamide.
| Compound Name | 4-[[[2-[[2-[[2-[(2-formamidoacetyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]methylsulfanyl]-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 171831062 |
| Molecular Formula | C24H36N6O6S |
| Molecular Weight | 536.66 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | 4-[[[2-[[2-[[2-[(2-formamidoacetyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]methylsulfanyl]-N,4-dimethylpentanamide |
| SMILES | CNC(=O)CCC(C)(C)SCNC(=O)CNC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CNC=O |
| InChI | InChI=1S/C24H36N6O6S/c1-24(2,10-9-19(32)25-3)37-16-29-21(34)13-28-23(36)18(11-17-7-5-4-6-8-17)30-22(35)14-27-20(33)12-26-15-31/h4-8,15,18H,9-14,16H2,1-3H3,(H,25,32)(H,26,31)(H,27,33)(H,28,36)(H,29,34)(H,30,35) |
| InChIKey | AORJDYWASFMTNF-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 174.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.66 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|