C22H34N4O4 — CID 176965756
N-[2-[[2-[[(2S)-1-(ethylamino)-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]heptanamide (PubChem CID 176965756) has the molecular formula C22H34N4O4 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-[2-[[2-[[(2S)-1-(ethylamino)-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]heptanamide.
| Compound Name | N-[2-[[2-[[(2S)-1-(ethylamino)-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]heptanamide |
|---|---|
| PubChem CID | 176965756 |
| Molecular Formula | C22H34N4O4 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | N-[2-[[2-[[(2S)-1-(ethylamino)-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]heptanamide |
| SMILES | CCCCCCC(=O)NCC(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)NCC |
| InChI | InChI=1S/C22H34N4O4/c1-3-5-6-10-13-19(27)24-15-20(28)25-16-21(29)26-18(22(30)23-4-2)14-17-11-8-7-9-12-17/h7-9,11-12,18H,3-6,10,13-16H2,1-2H3,(H,23,30)(H,24,27)(H,25,28)(H,26,29)/t18-/m0/s1 |
| InChIKey | IIAZCHOFVIMYTP-SFHVURJKSA-N |
| XLogP | 1.05 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|