C19H29NNaO3 — CID 160842704
CID 160842704 (PubChem CID 160842704) has the molecular formula C19H29NNaO3 and a molecular weight of 342.44 g/mol.
| Compound Name | CID 160842704 |
|---|---|
| PubChem CID | 160842704 |
| Molecular Formula | C19H29NNaO3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCC(=O)N[C@@H](Cc1ccccc1)C(=O)O.[Na] |
| InChI | InChI=1S/C19H29NO3.Na/c1-2-3-4-5-6-7-11-14-18(21)20-17(19(22)23)15-16-12-9-8-10-13-16;/h8-10,12-13,17H,2-7,11,14-15H2,1H3,(H,20,21)(H,22,23);/t17-;/m0./s1 |
| InChIKey | SIFVSHXNUMJPMN-LMOVPXPDSA-N |
| XLogP | 3.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|