C28H36N2O6 — CID 22869856
(2S)-2-[[10-[[(1S)-1-carboxy-2-phenylethyl]amino]-10-oxodecanoyl]amino]-3-phenylpropanoic acid (PubChem CID 22869856) has the molecular formula C28H36N2O6 and a molecular weight of 496.60 g/mol. Its IUPAC name is (2S)-2-[[10-[[(1S)-1-carboxy-2-phenylethyl]amino]-10-oxodecanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[10-[[(1S)-1-carboxy-2-phenylethyl]amino]-10-oxodecanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22869856 |
| Molecular Formula | C28H36N2O6 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | (2S)-2-[[10-[[(1S)-1-carboxy-2-phenylethyl]amino]-10-oxodecanoyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(CCCCCCCCC(=O)N[C@@H](Cc1ccccc1)C(=O)O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C28H36N2O6/c31-25(29-23(27(33)34)19-21-13-7-5-8-14-21)17-11-3-1-2-4-12-18-26(32)30-24(28(35)36)20-22-15-9-6-10-16-22/h5-10,13-16,23-24H,1-4,11-12,17-20H2,(H,29,31)(H,30,32)(H,33,34)(H,35,36)/t23-,24-/m0/s1 |
| InChIKey | JELUWSKDUHJUND-ZEQRLZLVSA-N |
| XLogP | 3.73 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|