C29H38N2O4 — CID 70673825
3-phenyl-2-[[3-phenyl-2-(undec-10-enoylamino)propanoyl]amino]propanoic acid (PubChem CID 70673825) has the molecular formula C29H38N2O4 and a molecular weight of 478.63 g/mol. Its IUPAC name is 3-phenyl-2-[[3-phenyl-2-(undec-10-enoylamino)propanoyl]amino]propanoic acid.
| Compound Name | 3-phenyl-2-[[3-phenyl-2-(undec-10-enoylamino)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70673825 |
| Molecular Formula | C29H38N2O4 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | 3-phenyl-2-[[3-phenyl-2-(undec-10-enoylamino)propanoyl]amino]propanoic acid |
| SMILES | C=CCCCCCCCCC(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C29H38N2O4/c1-2-3-4-5-6-7-8-15-20-27(32)30-25(21-23-16-11-9-12-17-23)28(33)31-26(29(34)35)22-24-18-13-10-14-19-24/h2,9-14,16-19,25-26H,1,3-8,15,20-22H2,(H,30,32)(H,31,33)(H,34,35) |
| InChIKey | WNWOZZIBKRFVES-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|