C17H24N2O5 — CID 11024167
(2R)-2-[[8-(hydroxyamino)-8-oxooctanoyl]amino]-3-phenylpropanoic acid (PubChem CID 11024167) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is (2R)-2-[[8-(hydroxyamino)-8-oxooctanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[8-(hydroxyamino)-8-oxooctanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 11024167 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | (2R)-2-[[8-(hydroxyamino)-8-oxooctanoyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(CCCCCCC(=O)N[C@H](Cc1ccccc1)C(=O)O)NO |
| InChI | InChI=1S/C17H24N2O5/c20-15(10-6-1-2-7-11-16(21)19-24)18-14(17(22)23)12-13-8-4-3-5-9-13/h3-5,8-9,14,24H,1-2,6-7,10-12H2,(H,18,20)(H,19,21)(H,22,23)/t14-/m1/s1 |
| InChIKey | ULHQUNKWQUAIGA-CQSZACIVSA-N |
| XLogP | 1.64 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|