C17H25N3O4 — CID 11002177
N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-N'-hydroxyoctanediamide (PubChem CID 11002177) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-N'-hydroxyoctanediamide.
| Compound Name | N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 11002177 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-N'-hydroxyoctanediamide |
| SMILES | NC(=O)[C@H](Cc1ccccc1)NC(=O)CCCCCCC(=O)NO |
| InChI | InChI=1S/C17H25N3O4/c18-17(23)14(12-13-8-4-3-5-9-13)19-15(21)10-6-1-2-7-11-16(22)20-24/h3-5,8-9,14,24H,1-2,6-7,10-12H2,(H2,18,23)(H,19,21)(H,20,22)/t14-/m0/s1 |
| InChIKey | BLQUOYXCNRHVJW-AWEZNQCLSA-N |
| XLogP | 1.05 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|