C21H27N3O6 — CID 89032054
(2,5-dioxopyrrolidin-1-yl) 8-[(1-amino-1-oxo-3-phenylpropan-2-yl)amino]-8-oxooctanoate (PubChem CID 89032054) has the molecular formula C21H27N3O6 and a molecular weight of 417.46 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 8-[(1-amino-1-oxo-3-phenylpropan-2-yl)amino]-8-oxooctanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 8-[(1-amino-1-oxo-3-phenylpropan-2-yl)amino]-8-oxooctanoate |
|---|---|
| PubChem CID | 89032054 |
| Molecular Formula | C21H27N3O6 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 8-[(1-amino-1-oxo-3-phenylpropan-2-yl)amino]-8-oxooctanoate |
| SMILES | NC(=O)C(Cc1ccccc1)NC(=O)CCCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C21H27N3O6/c22-21(29)16(14-15-8-4-3-5-9-15)23-17(25)10-6-1-2-7-11-20(28)30-24-18(26)12-13-19(24)27/h3-5,8-9,16H,1-2,6-7,10-14H2,(H2,22,29)(H,23,25) |
| InChIKey | XTBPQSQZFVYZIT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|