C15H16N2O5 — CID 129168004
(2,5-dioxopyrrolidin-1-yl) 5-anilino-5-oxopentanoate (PubChem CID 129168004) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-anilino-5-oxopentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-anilino-5-oxopentanoate |
|---|---|
| PubChem CID | 129168004 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-anilino-5-oxopentanoate |
| SMILES | O=C(CCCC(=O)ON1C(=O)CCC1=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H16N2O5/c18-12(16-11-5-2-1-3-6-11)7-4-8-15(21)22-17-13(19)9-10-14(17)20/h1-3,5-6H,4,7-10H2,(H,16,18) |
| InChIKey | CMBLHPPPPUJUPF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|