C24H24N2O8 — CID 14858795
2-[2-[4-[[5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxopentanoyl]amino]phenyl]-1-hydroxyethyl]benzoic acid (PubChem CID 14858795) has the molecular formula C24H24N2O8 and a molecular weight of 468.46 g/mol. Its IUPAC name is 2-[2-[4-[[5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxopentanoyl]amino]phenyl]-1-hydroxyethyl]benzoic acid.
| Compound Name | 2-[2-[4-[[5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxopentanoyl]amino]phenyl]-1-hydroxyethyl]benzoic acid |
|---|---|
| PubChem CID | 14858795 |
| Molecular Formula | C24H24N2O8 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 2-[2-[4-[[5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxopentanoyl]amino]phenyl]-1-hydroxyethyl]benzoic acid |
| SMILES | O=C(CCCC(=O)ON1C(=O)CCC1=O)Nc1ccc(CC(O)c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H24N2O8/c27-19(17-4-1-2-5-18(17)24(32)33)14-15-8-10-16(11-9-15)25-20(28)6-3-7-23(31)34-26-21(29)12-13-22(26)30/h1-2,4-5,8-11,19,27H,3,6-7,12-14H2,(H,25,28)(H,32,33) |
| InChIKey | GRQBVKWZXQLMIH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|