C11H14N2O8 — CID 87746773
5-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[2-(hydroxyamino)-2-oxoethyl] pentanedioate (PubChem CID 87746773) has the molecular formula C11H14N2O8 and a molecular weight of 302.24 g/mol. Its IUPAC name is 5-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[2-(hydroxyamino)-2-oxoethyl] pentanedioate.
| Compound Name | 5-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[2-(hydroxyamino)-2-oxoethyl] pentanedioate |
|---|---|
| PubChem CID | 87746773 |
| Molecular Formula | C11H14N2O8 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 5-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[2-(hydroxyamino)-2-oxoethyl] pentanedioate |
| SMILES | O=C(COC(=O)CCCC(=O)ON1C(=O)CCC1=O)NO |
| InChI | InChI=1S/C11H14N2O8/c14-7(12-19)6-20-10(17)2-1-3-11(18)21-13-8(15)4-5-9(13)16/h19H,1-6H2,(H,12,14) |
| InChIKey | RGIUKCNZVHDXOA-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|