C9H14N2O4 — CID 129055925
(2,5-dioxopyrrolidin-1-yl) 5-aminopentanoate (PubChem CID 129055925) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-aminopentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-aminopentanoate |
|---|---|
| PubChem CID | 129055925 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-aminopentanoate |
| SMILES | NCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H14N2O4/c10-6-2-1-3-9(14)15-11-7(12)4-5-8(11)13/h1-6,10H2 |
| InChIKey | WVNVOZXJZWPCBA-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|