C20H30N3O8+ — CID 177070574
[5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxopentyl]-[5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxo(1,2,4,5-13C4)pentyl]-dimethylazanium (PubChem CID 177070574) has the molecular formula C20H30N3O8+ and a molecular weight of 444.44 g/mol. Its IUPAC name is [5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxopentyl]-[5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxo(1,2,4,5-13C4)pentyl]-dimethylazanium.
| Compound Name | [5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxopentyl]-[5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxo(1,2,4,5-13C4)pentyl]-dimethylazanium |
|---|---|
| PubChem CID | 177070574 |
| Molecular Formula | C20H30N3O8+ |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | [5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxopentyl]-[5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxo(1,2,4,5-13C4)pentyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCCC(=O)ON1C(=O)CCC1=O)[13CH2][13CH2]C[13CH2][13C](=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C20H30N3O8/c1-23(2,13-5-3-7-19(28)30-21-15(24)9-10-16(21)25)14-6-4-8-20(29)31-22-17(26)11-12-18(22)27/h3-14H2,1-2H3/q+1/i5+1,7+1,13+1,19+1 |
| InChIKey | BRQHJLKBCBNFKI-SUZOCVSFSA-N |
| XLogP | 0.62 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|