C12H19NO5 — CID 90394451
(2,5-dioxopyrrolidin-1-yl) 7-methoxyheptanoate (PubChem CID 90394451) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 7-methoxyheptanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 7-methoxyheptanoate |
|---|---|
| PubChem CID | 90394451 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 7-methoxyheptanoate |
| SMILES | COCCCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H19NO5/c1-17-9-5-3-2-4-6-12(16)18-13-10(14)7-8-11(13)15/h2-9H2,1H3 |
| InChIKey | VZHIBPQVNGEPGU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|