C13H20N2O7 — CID 59112809
(2,5-dioxopyrrolidin-1-yl) 5-(2-methoxyethoxycarbonylamino)pentanoate (PubChem CID 59112809) has the molecular formula C13H20N2O7 and a molecular weight of 316.31 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-(2-methoxyethoxycarbonylamino)pentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-(2-methoxyethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 59112809 |
| Molecular Formula | C13H20N2O7 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-(2-methoxyethoxycarbonylamino)pentanoate |
| SMILES | COCCOC(=O)NCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C13H20N2O7/c1-20-8-9-21-13(19)14-7-3-2-4-12(18)22-15-10(16)5-6-11(15)17/h2-9H2,1H3,(H,14,19) |
| InChIKey | VELIIBXPEOKWMT-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|