C13H20N2O5 — CID 142436920
(2,5-dioxopyrrolidin-1-yl) 9-amino-9-oxononanoate (PubChem CID 142436920) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 9-amino-9-oxononanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 9-amino-9-oxononanoate |
|---|---|
| PubChem CID | 142436920 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 9-amino-9-oxononanoate |
| SMILES | NC(=O)CCCCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C13H20N2O5/c14-10(16)6-4-2-1-3-5-7-13(19)20-15-11(17)8-9-12(15)18/h1-9H2,(H2,14,16) |
| InChIKey | RIAIYGVCOWHMIF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|