C16H25NO7 — CID 174881111
10-O-(2,5-dioxopyrrolidin-1-yl) 1-O-(2-hydroxyethyl) decanedioate (PubChem CID 174881111) has the molecular formula C16H25NO7 and a molecular weight of 343.38 g/mol. Its IUPAC name is 10-O-(2,5-dioxopyrrolidin-1-yl) 1-O-(2-hydroxyethyl) decanedioate.
| Compound Name | 10-O-(2,5-dioxopyrrolidin-1-yl) 1-O-(2-hydroxyethyl) decanedioate |
|---|---|
| PubChem CID | 174881111 |
| Molecular Formula | C16H25NO7 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 10-O-(2,5-dioxopyrrolidin-1-yl) 1-O-(2-hydroxyethyl) decanedioate |
| SMILES | O=C(CCCCCCCCC(=O)ON1C(=O)CCC1=O)OCCO |
| InChI | InChI=1S/C16H25NO7/c18-11-12-23-15(21)7-5-3-1-2-4-6-8-16(22)24-17-13(19)9-10-14(17)20/h18H,1-12H2 |
| InChIKey | NWRGEEKZAYGJFD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|