About 1-O-(2-hydroxyethyl) 6-O-(2-oxo-5-sulfanylidenepyrrolidin-1-yl) hexanedioate
1-O-(2-hydroxyethyl) 6-O-(2-oxo-5-sulfanylidenepyrrolidin-1-yl) hexanedioate (PubChem CID 87744435) has the molecular formula C12H17NO6S
and a molecular weight of 303.34 g/mol. Its IUPAC name is 1-O-(2-hydroxyethyl) 6-O-(2-oxo-5-sulfanylidenepyrrolidin-1-yl) hexanedioate.
Molecular Properties
| Compound Name | 1-O-(2-hydroxyethyl) 6-O-(2-oxo-5-sulfanylidenepyrrolidin-1-yl) hexanedioate |
| PubChem CID | 87744435 |
| Molecular Formula | C12H17NO6S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 1-O-(2-hydroxyethyl) 6-O-(2-oxo-5-sulfanylidenepyrrolidin-1-yl) hexanedioate |
| SMILES | O=C(CCCCC(=O)ON1C(=O)CCC1=S)OCCO |
| InChI | InChI=1S/C12H17NO6S/c14-7-8-18-11(16)3-1-2-4-12(17)19-13-9(15)5-6-10(13)20/h14H,1-8H2 |
| InChIKey | LCRQPLJMHSPLFA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(2-hydroxyethyl) 6-O-(2-oxo-5-sulfanylidenepyrrolidin-1-yl) hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(2-hydroxyethyl) 6-O-(2-oxo-5-sulfanylidenepyrrolidin-1-yl) hexanedioate?
The IUPAC name of 1-O-(2-hydroxyethyl) 6-O-(2-oxo-5-sulfanylidenepyrrolidin-1-yl) hexanedioate (CID 87744435) is 1-O-(2-hydroxyethyl) 6-O-(2-oxo-5-sulfanylidenepyrrolidin-1-yl) hexanedioate.
What is the SMILES notation for 1-O-(2-hydroxyethyl) 6-O-(2-oxo-5-sulfanylidenepyrrolidin-1-yl) hexanedioate?
The canonical SMILES for 1-O-(2-hydroxyethyl) 6-O-(2-oxo-5-sulfanylidenepyrrolidin-1-yl) hexanedioate is O=C(CCCCC(=O)ON1C(=O)CCC1=S)OCCO.
What is the InChIKey of 1-O-(2-hydroxyethyl) 6-O-(2-oxo-5-sulfanylidenepyrrolidin-1-yl) hexanedioate?
The InChIKey is LCRQPLJMHSPLFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO6S/c14-7-8-18-11(16)3-1-2-4-12(17)19-13-9(15)5-6-10(13)20/h14H,1-8H2.
What are the key properties of 1-O-(2-hydroxyethyl) 6-O-(2-oxo-5-sulfanylidenepyrrolidin-1-yl) hexanedioate?
1-O-(2-hydroxyethyl) 6-O-(2-oxo-5-sulfanylidenepyrrolidin-1-yl) hexanedioate has a molecular weight of 303.34 g/mol, XLogP of 0.49, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(2-hydroxyethyl) 6-O-(2-oxo-5-sulfanylidenepyrrolidin-1-yl) hexanedioate is sourced from PubChem (CID 87744435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).