C22H28N2O13 — CID 160965855
4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[3-[3-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutanoyl]oxypropoxy]propyl] butanedioate (PubChem CID 160965855) has the molecular formula C22H28N2O13 and a molecular weight of 528.47 g/mol. Its IUPAC name is 4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[3-[3-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutanoyl]oxypropoxy]propyl] butanedioate.
| Compound Name | 4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[3-[3-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutanoyl]oxypropoxy]propyl] butanedioate |
|---|---|
| PubChem CID | 160965855 |
| Molecular Formula | C22H28N2O13 |
| Molecular Weight | 528.47 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[3-[3-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutanoyl]oxypropoxy]propyl] butanedioate |
| SMILES | O=C(CCC(=O)ON1C(=O)CCC1=O)OCCCOCCCOC(=O)CCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C22H28N2O13/c25-15-3-4-16(26)23(15)36-21(31)9-7-19(29)34-13-1-11-33-12-2-14-35-20(30)8-10-22(32)37-24-17(27)5-6-18(24)28/h1-14H2 |
| InChIKey | QWHJTBPEWJXVCO-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 189.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.47 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|