C29H38N2O14 — CID 158122544
(2,5-dioxopyrrolidin-1-yl) 9-[3-[9-(2,5-dioxopyrrolidin-1-yl)oxy-3,6,9-trioxononoxy]propoxy]-4,7-dioxononanoate (PubChem CID 158122544) has the molecular formula C29H38N2O14 and a molecular weight of 638.62 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 9-[3-[9-(2,5-dioxopyrrolidin-1-yl)oxy-3,6,9-trioxononoxy]propoxy]-4,7-dioxononanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 9-[3-[9-(2,5-dioxopyrrolidin-1-yl)oxy-3,6,9-trioxononoxy]propoxy]-4,7-dioxononanoate |
|---|---|
| PubChem CID | 158122544 |
| Molecular Formula | C29H38N2O14 |
| Molecular Weight | 638.62 g/mol |
| Exact Mass | 638.23 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 9-[3-[9-(2,5-dioxopyrrolidin-1-yl)oxy-3,6,9-trioxononoxy]propoxy]-4,7-dioxononanoate |
| SMILES | O=C(CCOCCCOCCC(=O)CCC(=O)CCC(=O)ON1C(=O)CCC1=O)CCC(=O)CCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C29H38N2O14/c32-20(6-12-28(40)44-30-24(36)8-9-25(30)37)2-4-22(34)14-18-42-16-1-17-43-19-15-23(35)5-3-21(33)7-13-29(41)45-31-26(38)10-11-27(31)39/h1-19H2 |
| InChIKey | FRTVBQYTFKAYAW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 214.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.62 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|