C15H22N2O8 — CID 123274053
(2,5-dioxopyrrolidin-1-yl) 7-[2-[(2Z)-2-hydroxyiminoethoxy]ethoxy]-4-oxoheptanoate (PubChem CID 123274053) has the molecular formula C15H22N2O8 and a molecular weight of 358.35 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 7-[2-[(2Z)-2-hydroxyiminoethoxy]ethoxy]-4-oxoheptanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 7-[2-[(2Z)-2-hydroxyiminoethoxy]ethoxy]-4-oxoheptanoate |
|---|---|
| PubChem CID | 123274053 |
| Molecular Formula | C15H22N2O8 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 7-[2-[(2Z)-2-hydroxyiminoethoxy]ethoxy]-4-oxoheptanoate |
| SMILES | O=C(CCCOCCOC/C=N\O)CCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C15H22N2O8/c18-12(2-1-8-23-10-11-24-9-7-16-22)3-6-15(21)25-17-13(19)4-5-14(17)20/h7,22H,1-6,8-11H2/b16-7- |
| InChIKey | DLZBEDOAQMWURD-APSNUPSMSA-N |
| XLogP | 0.22 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|