C27H40N2O13 — CID 160762335
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 160762335) has the molecular formula C27H40N2O13 and a molecular weight of 600.62 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 160762335 |
| Molecular Formula | C27H40N2O13 |
| Molecular Weight | 600.62 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | O=C(CCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C27H40N2O13/c30-22(7-9-28-23(31)3-4-24(28)32)2-1-10-36-12-14-38-16-18-40-20-21-41-19-17-39-15-13-37-11-8-27(35)42-29-25(33)5-6-26(29)34/h3-4H,1-2,5-21H2 |
| InChIKey | DHZFPISPGUJWDZ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 173.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.62 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|